C18H14ClN5OS — CID 90320728
[5-(2-aminopyrimidin-4-yl)-2-(1H-imidazol-2-yl)thiophen-3-yl]-(4-chlorophenyl)methanol (PubChem CID 90320728) has the molecular formula C18H14ClN5OS and a molecular weight of 383.86 g/mol. Its IUPAC name is [5-(2-aminopyrimidin-4-yl)-2-(1H-imidazol-2-yl)thiophen-3-yl]-(4-chlorophenyl)methanol.
| Compound Name | [5-(2-aminopyrimidin-4-yl)-2-(1H-imidazol-2-yl)thiophen-3-yl]-(4-chlorophenyl)methanol |
|---|---|
| PubChem CID | 90320728 |
| Molecular Formula | C18H14ClN5OS |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | [5-(2-aminopyrimidin-4-yl)-2-(1H-imidazol-2-yl)thiophen-3-yl]-(4-chlorophenyl)methanol |
| SMILES | Nc1nccc(-c2cc(C(O)c3ccc(Cl)cc3)c(-c3ncc[nH]3)s2)n1 |
| InChI | InChI=1S/C18H14ClN5OS/c19-11-3-1-10(2-4-11)15(25)12-9-14(13-5-6-23-18(20)24-13)26-16(12)17-21-7-8-22-17/h1-9,15,25H,(H,21,22)(H2,20,23,24) |
| InChIKey | RDLYVNXLYXBPTG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |