C18H12ClFN4OS — CID 90320762
(4-chlorophenyl)-[5-(5-fluoropyrimidin-4-yl)-2-(1H-imidazol-2-yl)thiophen-3-yl]methanol (PubChem CID 90320762) has the molecular formula C18H12ClFN4OS and a molecular weight of 386.84 g/mol. Its IUPAC name is (4-chlorophenyl)-[5-(5-fluoropyrimidin-4-yl)-2-(1H-imidazol-2-yl)thiophen-3-yl]methanol.
| Compound Name | (4-chlorophenyl)-[5-(5-fluoropyrimidin-4-yl)-2-(1H-imidazol-2-yl)thiophen-3-yl]methanol |
|---|---|
| PubChem CID | 90320762 |
| Molecular Formula | C18H12ClFN4OS |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | (4-chlorophenyl)-[5-(5-fluoropyrimidin-4-yl)-2-(1H-imidazol-2-yl)thiophen-3-yl]methanol |
| SMILES | OC(c1ccc(Cl)cc1)c1cc(-c2ncncc2F)sc1-c1ncc[nH]1 |
| InChI | InChI=1S/C18H12ClFN4OS/c19-11-3-1-10(2-4-11)16(25)12-7-14(15-13(20)8-21-9-24-15)26-17(12)18-22-5-6-23-18/h1-9,16,25H,(H,22,23) |
| InChIKey | VGXJCYJXHUSAQL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |