C19H12ClN5OS — CID 88589292
(R)-(4-chlorophenyl)-[5-(2-isocyano-4-pyridinyl)-2-(1H-1,2,4-triazol-5-yl)thiophen-3-yl]methanol (PubChem CID 88589292) has the molecular formula C19H12ClN5OS and a molecular weight of 393.86 g/mol. Its IUPAC name is (R)-(4-chlorophenyl)-[5-(2-isocyano-4-pyridinyl)-2-(1H-1,2,4-triazol-5-yl)thiophen-3-yl]methanol.
| Compound Name | (R)-(4-chlorophenyl)-[5-(2-isocyano-4-pyridinyl)-2-(1H-1,2,4-triazol-5-yl)thiophen-3-yl]methanol |
|---|---|
| PubChem CID | 88589292 |
| Molecular Formula | C19H12ClN5OS |
| Molecular Weight | 393.86 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | (R)-(4-chlorophenyl)-[5-(2-isocyano-4-pyridinyl)-2-(1H-1,2,4-triazol-5-yl)thiophen-3-yl]methanol |
| SMILES | [C-]#[N+]c1cc(-c2cc([C@H](O)c3ccc(Cl)cc3)c(-c3ncn[nH]3)s2)ccn1 |
| InChI | InChI=1S/C19H12ClN5OS/c1-21-16-8-12(6-7-22-16)15-9-14(18(27-15)19-23-10-24-25-19)17(26)11-2-4-13(20)5-3-11/h2-10,17,26H,(H,23,24,25)/t17-/m1/s1 |
| InChIKey | BCIRGWNKTOOEPD-QGZVFWFLSA-N |
| XLogP | 4.88 |
| TPSA | 79.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.86 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|