C16H14FN5OS — CID 143117498
N-[(2-amino-6-fluorophenyl)methyl]-5-(2-aminopyrimidin-4-yl)thiophene-2-carboxamide (PubChem CID 143117498) has the molecular formula C16H14FN5OS and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[(2-amino-6-fluorophenyl)methyl]-5-(2-aminopyrimidin-4-yl)thiophene-2-carboxamide.
| Compound Name | N-[(2-amino-6-fluorophenyl)methyl]-5-(2-aminopyrimidin-4-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 143117498 |
| Molecular Formula | C16H14FN5OS |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-[(2-amino-6-fluorophenyl)methyl]-5-(2-aminopyrimidin-4-yl)thiophene-2-carboxamide |
| SMILES | Nc1nccc(-c2ccc(C(=O)NCc3c(N)cccc3F)s2)n1 |
| InChI | InChI=1S/C16H14FN5OS/c17-10-2-1-3-11(18)9(10)8-21-15(23)14-5-4-13(24-14)12-6-7-20-16(19)22-12/h1-7H,8,18H2,(H,21,23)(H2,19,20,22) |
| InChIKey | KZQWWSVKNNSPCG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|