C34H42N2O4 — CID 59469700
6-cyclohexyl-13-(4-octylcyclohexyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 59469700) has the molecular formula C34H42N2O4 and a molecular weight of 542.72 g/mol. Its IUPAC name is 6-cyclohexyl-13-(4-octylcyclohexyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-cyclohexyl-13-(4-octylcyclohexyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 59469700 |
| Molecular Formula | C34H42N2O4 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | 6-cyclohexyl-13-(4-octylcyclohexyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCCCCCCCC1CCC(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(C2CCCCC2)C4=O)CC1 |
| InChI | InChI=1S/C34H42N2O4/c1-2-3-4-5-6-8-11-22-14-16-24(17-15-22)36-33(39)27-20-18-25-29-26(19-21-28(30(27)29)34(36)40)32(38)35(31(25)37)23-12-9-7-10-13-23/h18-24H,2-17H2,1H3 |
| InChIKey | QYYLASNAJPWWMB-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|