C10H18O2 — CID 59470661
1,4-di(propan-2-yloxy)but-2-yne (PubChem CID 59470661) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 1,4-di(propan-2-yloxy)but-2-yne.
| Compound Name | 1,4-di(propan-2-yloxy)but-2-yne |
|---|---|
| PubChem CID | 59470661 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 1,4-di(propan-2-yloxy)but-2-yne |
| SMILES | CC(C)OCC#CCOC(C)C |
| InChI | InChI=1S/C10H18O2/c1-9(2)11-7-5-6-8-12-10(3)4/h9-10H,7-8H2,1-4H3 |
| InChIKey | ABJKLHKUONXFAD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|