C25H25N7O3 — CID 59473076
2-[2-morpholin-4-yl-5-[[6-(1H-pyrrolo[3,2-b]pyridin-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenoxy]ethanol (PubChem CID 59473076) has the molecular formula C25H25N7O3 and a molecular weight of 471.52 g/mol. Its IUPAC name is 2-[2-morpholin-4-yl-5-[[6-(1H-pyrrolo[3,2-b]pyridin-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenoxy]ethanol.
| Compound Name | 2-[2-morpholin-4-yl-5-[[6-(1H-pyrrolo[3,2-b]pyridin-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenoxy]ethanol |
|---|---|
| PubChem CID | 59473076 |
| Molecular Formula | C25H25N7O3 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 2-[2-morpholin-4-yl-5-[[6-(1H-pyrrolo[3,2-b]pyridin-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenoxy]ethanol |
| SMILES | OCCOc1cc(Nc2nc(-c3cnc4cc[nH]c4c3)cn3ccnc23)ccc1N1CCOCC1 |
| InChI | InChI=1S/C25H25N7O3/c33-9-12-35-23-14-18(1-2-22(23)31-7-10-34-11-8-31)29-24-25-27-5-6-32(25)16-21(30-24)17-13-20-19(28-15-17)3-4-26-20/h1-6,13-16,26,33H,7-12H2,(H,29,30) |
| InChIKey | PSDSUCBGSUANHG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 112.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|