C27H30N8O2 — CID 59473323
6-(1H-indazol-6-yl)-N-[3-methoxy-4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 59473323) has the molecular formula C27H30N8O2 and a molecular weight of 498.59 g/mol. Its IUPAC name is 6-(1H-indazol-6-yl)-N-[3-methoxy-4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-(1H-indazol-6-yl)-N-[3-methoxy-4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 59473323 |
| Molecular Formula | C27H30N8O2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 6-(1H-indazol-6-yl)-N-[3-methoxy-4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | COCCN1CCN(c2ccc(Nc3nc(-c4ccc5cn[nH]c5c4)cn4ccnc34)cc2OC)CC1 |
| InChI | InChI=1S/C27H30N8O2/c1-36-14-13-33-9-11-34(12-10-33)24-6-5-21(16-25(24)37-2)30-26-27-28-7-8-35(27)18-23(31-26)19-3-4-20-17-29-32-22(20)15-19/h3-8,15-18H,9-14H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | OGFCAGIVVRSUBJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|