C29H42N4O6S — CID 59475625
methyl (2S)-3-(1H-indol-3-yl)-2-[[(2S)-2-[[(2R)-3-(3-methylpent-1-en-3-ylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoyl]amino]propanoate (PubChem CID 59475625) has the molecular formula C29H42N4O6S and a molecular weight of 574.74 g/mol. Its IUPAC name is methyl (2S)-3-(1H-indol-3-yl)-2-[[(2S)-2-[[(2R)-3-(3-methylpent-1-en-3-ylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoyl]amino]propanoate.
| Compound Name | methyl (2S)-3-(1H-indol-3-yl)-2-[[(2S)-2-[[(2R)-3-(3-methylpent-1-en-3-ylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 59475625 |
| Molecular Formula | C29H42N4O6S |
| Molecular Weight | 574.74 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | methyl (2S)-3-(1H-indol-3-yl)-2-[[(2S)-2-[[(2R)-3-(3-methylpent-1-en-3-ylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoyl]amino]propanoate |
| SMILES | C=CC(C)(CC)SC[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OC |
| InChI | InChI=1S/C29H42N4O6S/c1-9-29(7,10-2)40-17-23(33-27(37)39-28(4,5)6)25(35)31-18(3)24(34)32-22(26(36)38-8)15-19-16-30-21-14-12-11-13-20(19)21/h9,11-14,16,18,22-23,30H,1,10,15,17H2,2-8H3,(H,31,35)(H,32,34)(H,33,37)/t18-,22-,23-,29?/m0/s1 |
| InChIKey | VAGGAIXWJNZFBG-YFEKPBIVSA-N |
| XLogP | 3.85 |
| TPSA | 138.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|