C25H25NO2S — CID 59476635
N-[4-(4-benzoylphenyl)sulfanylphenyl]-2,2-dimethylbutanamide (PubChem CID 59476635) has the molecular formula C25H25NO2S and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[4-(4-benzoylphenyl)sulfanylphenyl]-2,2-dimethylbutanamide.
| Compound Name | N-[4-(4-benzoylphenyl)sulfanylphenyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 59476635 |
| Molecular Formula | C25H25NO2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[4-(4-benzoylphenyl)sulfanylphenyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1ccc(Sc2ccc(C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H25NO2S/c1-4-25(2,3)24(28)26-20-12-16-22(17-13-20)29-21-14-10-19(11-15-21)23(27)18-8-6-5-7-9-18/h5-17H,4H2,1-3H3,(H,26,28) |
| InChIKey | LKVKHIHMOXKDOK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |