C29H32O4S — CID 59476634
2-[2-[4-(4-benzoylphenyl)sulfanylphenyl]ethoxy]ethyl 2,2-dimethylbutanoate (PubChem CID 59476634) has the molecular formula C29H32O4S and a molecular weight of 476.64 g/mol. Its IUPAC name is 2-[2-[4-(4-benzoylphenyl)sulfanylphenyl]ethoxy]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[2-[4-(4-benzoylphenyl)sulfanylphenyl]ethoxy]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59476634 |
| Molecular Formula | C29H32O4S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 2-[2-[4-(4-benzoylphenyl)sulfanylphenyl]ethoxy]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOCCc1ccc(Sc2ccc(C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H32O4S/c1-4-29(2,3)28(31)33-21-20-32-19-18-22-10-14-25(15-11-22)34-26-16-12-24(13-17-26)27(30)23-8-6-5-7-9-23/h5-17H,4,18-21H2,1-3H3 |
| InChIKey | JAIFBHBADLSGQT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|