C27H34ClN3O2 — CID 59477169
1-(3-chloro-4-isocyanophenyl)-4-[2-[4-(1-pyrrolidin-1-ylpropyl)phenoxy]ethyl]piperidin-4-ol (PubChem CID 59477169) has the molecular formula C27H34ClN3O2 and a molecular weight of 468.04 g/mol. Its IUPAC name is 1-(3-chloro-4-isocyanophenyl)-4-[2-[4-(1-pyrrolidin-1-ylpropyl)phenoxy]ethyl]piperidin-4-ol.
| Compound Name | 1-(3-chloro-4-isocyanophenyl)-4-[2-[4-(1-pyrrolidin-1-ylpropyl)phenoxy]ethyl]piperidin-4-ol |
|---|---|
| PubChem CID | 59477169 |
| Molecular Formula | C27H34ClN3O2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 1-(3-chloro-4-isocyanophenyl)-4-[2-[4-(1-pyrrolidin-1-ylpropyl)phenoxy]ethyl]piperidin-4-ol |
| SMILES | [C-]#[N+]c1ccc(N2CCC(O)(CCOc3ccc(C(CC)N4CCCC4)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C27H34ClN3O2/c1-3-26(31-15-4-5-16-31)21-6-9-23(10-7-21)33-19-14-27(32)12-17-30(18-13-27)22-8-11-25(29-2)24(28)20-22/h6-11,20,26,32H,3-5,12-19H2,1H3 |
| InChIKey | DUGVDJXIJAQALY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 40.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|