C24H27N3O7S — CID 59478842
2-[2-(methanesulfonamido)cyclohexyl]-3-(4-methyl-3-nitrophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid (PubChem CID 59478842) has the molecular formula C24H27N3O7S and a molecular weight of 501.56 g/mol. Its IUPAC name is 2-[2-(methanesulfonamido)cyclohexyl]-3-(4-methyl-3-nitrophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid.
| Compound Name | 2-[2-(methanesulfonamido)cyclohexyl]-3-(4-methyl-3-nitrophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 59478842 |
| Molecular Formula | C24H27N3O7S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 2-[2-(methanesulfonamido)cyclohexyl]-3-(4-methyl-3-nitrophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
| SMILES | Cc1ccc(C2C(C(=O)O)c3ccccc3C(=O)N2C2CCCCC2NS(C)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H27N3O7S/c1-14-11-12-15(13-20(14)27(31)32)22-21(24(29)30)16-7-3-4-8-17(16)23(28)26(22)19-10-6-5-9-18(19)25-35(2,33)34/h3-4,7-8,11-13,18-19,21-22,25H,5-6,9-10H2,1-2H3,(H,29,30) |
| InChIKey | BZVSQSMJENJUDE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|