C23H23Cl2N3O7S — CID 59479197
(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid (PubChem CID 59479197) has the molecular formula C23H23Cl2N3O7S and a molecular weight of 556.42 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 59479197 |
| Molecular Formula | C23H23Cl2N3O7S |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 555.06 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
| SMILES | CS(=O)(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccc([N+](=O)[O-])cc2[C@@H](C(=O)O)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H23Cl2N3O7S/c1-36(34,35)26-18-4-2-3-5-19(18)27-21(15-8-6-12(24)10-17(15)25)20(23(30)31)16-11-13(28(32)33)7-9-14(16)22(27)29/h6-11,18-21,26H,2-5H2,1H3,(H,30,31)/t18-,19-,20+,21-/m0/s1 |
| InChIKey | YAOPQJDGEUQZRR-BURNTYAHSA-N |
| XLogP | 4.13 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|