C23H23Cl2N5O5S — CID 118358293
(3R,4R)-2-[(1R,2R)-2-(azidomethylsulfonylamino)cyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid (PubChem CID 118358293) has the molecular formula C23H23Cl2N5O5S and a molecular weight of 552.44 g/mol. Its IUPAC name is (3R,4R)-2-[(1R,2R)-2-(azidomethylsulfonylamino)cyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid.
| Compound Name | (3R,4R)-2-[(1R,2R)-2-(azidomethylsulfonylamino)cyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 118358293 |
| Molecular Formula | C23H23Cl2N5O5S |
| Molecular Weight | 552.44 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | (3R,4R)-2-[(1R,2R)-2-(azidomethylsulfonylamino)cyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
| SMILES | [N-]=[N+]=NCS(=O)(=O)N[C@@H]1CCCC[C@H]1N1C(=O)c2ccccc2[C@@H](C(=O)O)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H23Cl2N5O5S/c24-13-9-10-16(17(25)11-13)21-20(23(32)33)14-5-1-2-6-15(14)22(31)30(21)19-8-4-3-7-18(19)28-36(34,35)12-27-29-26/h1-2,5-6,9-11,18-21,28H,3-4,7-8,12H2,(H,32,33)/t18-,19-,20-,21+/m1/s1 |
| InChIKey | BJVURIGHQJXIBV-NCYKPQTJSA-N |
| XLogP | 4.86 |
| TPSA | 152.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|