C30H29Cl2N5O6S — CID 118358130
(3R,4R)-2-[(1S,2S)-2-(azidomethylsulfonylamino)cyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-6-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxylic acid (PubChem CID 118358130) has the molecular formula C30H29Cl2N5O6S and a molecular weight of 658.56 g/mol. Its IUPAC name is (3R,4R)-2-[(1S,2S)-2-(azidomethylsulfonylamino)cyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-6-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxylic acid.
| Compound Name | (3R,4R)-2-[(1S,2S)-2-(azidomethylsulfonylamino)cyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-6-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 118358130 |
| Molecular Formula | C30H29Cl2N5O6S |
| Molecular Weight | 658.56 g/mol |
| Exact Mass | 657.12 |
| IUPAC Name | (3R,4R)-2-[(1S,2S)-2-(azidomethylsulfonylamino)cyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-6-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxylic acid |
| SMILES | [N-]=[N+]=NCS(=O)(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccc(OCc3ccccc3)cc2[C@@H](C(=O)O)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H29Cl2N5O6S/c31-19-10-12-22(24(32)14-19)28-27(30(39)40)23-15-20(43-16-18-6-2-1-3-7-18)11-13-21(23)29(38)37(28)26-9-5-4-8-25(26)35-44(41,42)17-34-36-33/h1-3,6-7,10-15,25-28,35H,4-5,8-9,16-17H2,(H,39,40)/t25-,26-,27+,28-/m0/s1 |
| InChIKey | FMMYXQZYJJQPQZ-BPXGVECKSA-N |
| XLogP | 6.44 |
| TPSA | 161.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|