C29H29Cl2N3O3 — CID 59479044
(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1R,2R)-2-hydroxycyclohexyl]-1-oxo-N-(2-pyridin-2-ylethyl)-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59479044) has the molecular formula C29H29Cl2N3O3 and a molecular weight of 538.48 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1R,2R)-2-hydroxycyclohexyl]-1-oxo-N-(2-pyridin-2-ylethyl)-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1R,2R)-2-hydroxycyclohexyl]-1-oxo-N-(2-pyridin-2-ylethyl)-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59479044 |
| Molecular Formula | C29H29Cl2N3O3 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1R,2R)-2-hydroxycyclohexyl]-1-oxo-N-(2-pyridin-2-ylethyl)-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | O=C(NCCc1ccccn1)[C@@H]1c2ccccc2C(=O)N([C@@H]2CCCC[C@H]2O)[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H29Cl2N3O3/c30-18-12-13-22(23(31)17-18)27-26(28(36)33-16-14-19-7-5-6-15-32-19)20-8-1-2-9-21(20)29(37)34(27)24-10-3-4-11-25(24)35/h1-2,5-9,12-13,15,17,24-27,35H,3-4,10-11,14,16H2,(H,33,36)/t24-,25-,26-,27+/m1/s1 |
| InChIKey | IJDYHYLCQBKQIS-CWTOASCOSA-N |
| XLogP | 5.33 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |