C17H23F3O2 — CID 59481073
[2,3,3-trifluoro-4-(4-methylcyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] acetate (PubChem CID 59481073) has the molecular formula C17H23F3O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is [2,3,3-trifluoro-4-(4-methylcyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] acetate.
| Compound Name | [2,3,3-trifluoro-4-(4-methylcyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] acetate |
|---|---|
| PubChem CID | 59481073 |
| Molecular Formula | C17H23F3O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [2,3,3-trifluoro-4-(4-methylcyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] acetate |
| SMILES | CC(=O)OC12CCC(C3CC=C(C)CC3)(CC1)C(F)(F)C2F |
| InChI | InChI=1S/C17H23F3O2/c1-11-3-5-13(6-4-11)15-7-9-16(10-8-15,22-12(2)21)14(18)17(15,19)20/h3,13-14H,4-10H2,1-2H3 |
| InChIKey | GTKHURNZKDVMQE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|