C15H19F2I — CID 59481100
2,3-difluoro-1-iodo-4-(4-methylcyclohex-3-en-1-yl)bicyclo[2.2.2]oct-2-ene (PubChem CID 59481100) has the molecular formula C15H19F2I and a molecular weight of 364.22 g/mol. Its IUPAC name is 2,3-difluoro-1-iodo-4-(4-methylcyclohex-3-en-1-yl)bicyclo[2.2.2]oct-2-ene.
| Compound Name | 2,3-difluoro-1-iodo-4-(4-methylcyclohex-3-en-1-yl)bicyclo[2.2.2]oct-2-ene |
|---|---|
| PubChem CID | 59481100 |
| Molecular Formula | C15H19F2I |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2,3-difluoro-1-iodo-4-(4-methylcyclohex-3-en-1-yl)bicyclo[2.2.2]oct-2-ene |
| SMILES | CC1=CCC(C23CCC(I)(CC2)C(F)=C3F)CC1 |
| InChI | InChI=1S/C15H19F2I/c1-10-2-4-11(5-3-10)14-6-8-15(18,9-7-14)13(17)12(14)16/h2,11H,3-9H2,1H3 |
| InChIKey | SQLVEFUZRGYYJX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|