C8H16O5S — CID 59483277
3-(2-hydroxy-3,3-dimethoxypropyl)sulfanylpropanoic acid (PubChem CID 59483277) has the molecular formula C8H16O5S and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-(2-hydroxy-3,3-dimethoxypropyl)sulfanylpropanoic acid.
| Compound Name | 3-(2-hydroxy-3,3-dimethoxypropyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 59483277 |
| Molecular Formula | C8H16O5S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 3-(2-hydroxy-3,3-dimethoxypropyl)sulfanylpropanoic acid |
| SMILES | COC(OC)C(O)CSCCC(=O)O |
| InChI | InChI=1S/C8H16O5S/c1-12-8(13-2)6(9)5-14-4-3-7(10)11/h6,8-9H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | UMBNDRFIIQKRSC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|