C9H17NO4S — CID 115731565
3-[2-(2-methoxypropanoylamino)ethylsulfanyl]propanoic acid (PubChem CID 115731565) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is 3-[2-(2-methoxypropanoylamino)ethylsulfanyl]propanoic acid.
| Compound Name | 3-[2-(2-methoxypropanoylamino)ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 115731565 |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 3-[2-(2-methoxypropanoylamino)ethylsulfanyl]propanoic acid |
| SMILES | COC(C)C(=O)NCCSCCC(=O)O |
| InChI | InChI=1S/C9H17NO4S/c1-7(14-2)9(13)10-4-6-15-5-3-8(11)12/h7H,3-6H2,1-2H3,(H,10,13)(H,11,12) |
| InChIKey | BDCKVFJGOQMTLY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|