C8H16FNO4 — CID 143459457
ethane;3-[(2-fluoro-2-methoxyacetyl)amino]propanoic acid (PubChem CID 143459457) has the molecular formula C8H16FNO4 and a molecular weight of 209.22 g/mol. Its IUPAC name is ethane;3-[(2-fluoro-2-methoxyacetyl)amino]propanoic acid.
| Compound Name | ethane;3-[(2-fluoro-2-methoxyacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 143459457 |
| Molecular Formula | C8H16FNO4 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | ethane;3-[(2-fluoro-2-methoxyacetyl)amino]propanoic acid |
| SMILES | CC.COC(F)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C6H10FNO4.C2H6/c1-12-5(7)6(11)8-3-2-4(9)10;1-2/h5H,2-3H2,1H3,(H,8,11)(H,9,10);1-2H3 |
| InChIKey | VKJFNFPFICNOSM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |