C17H18F3NO5 — CID 59485976
(5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-5-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid (PubChem CID 59485976) has the molecular formula C17H18F3NO5 and a molecular weight of 373.33 g/mol. Its IUPAC name is (5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-5-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-5-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 59485976 |
| Molecular Formula | C17H18F3NO5 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-5-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C(C(=O)O)C[C@@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3NO5/c1-16(2,3)26-15(25)21-12(8-11(13(21)22)14(23)24)9-5-4-6-10(7-9)17(18,19)20/h4-7,11-12H,8H2,1-3H3,(H,23,24)/t11?,12-/m1/s1 |
| InChIKey | DZWSJDGAZTXOHY-PIJUOVFKSA-N |
| XLogP | 3.61 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|