C20H39N3O5S8 — CID 59488213
2-(2-hydroxyethylsulfanyl)ethoxy N-[2-[2-[2-[2-(2-methylsulfanylethyliminomethylsulfinyl)ethylsulfanylmethylsulfanyl]ethylsulfanylcarbonylamino]ethylsulfanylmethylsulfanyl]ethyl]methanimidate (PubChem CID 59488213) has the molecular formula C20H39N3O5S8 and a molecular weight of 658.08 g/mol. Its IUPAC name is 2-(2-hydroxyethylsulfanyl)ethoxy N-[2-[2-[2-[2-(2-methylsulfanylethyliminomethylsulfinyl)ethylsulfanylmethylsulfanyl]ethylsulfanylcarbonylamino]ethylsulfanylmethylsulfanyl]ethyl]methanimidate.
| Compound Name | 2-(2-hydroxyethylsulfanyl)ethoxy N-[2-[2-[2-[2-(2-methylsulfanylethyliminomethylsulfinyl)ethylsulfanylmethylsulfanyl]ethylsulfanylcarbonylamino]ethylsulfanylmethylsulfanyl]ethyl]methanimidate |
|---|---|
| PubChem CID | 59488213 |
| Molecular Formula | C20H39N3O5S8 |
| Molecular Weight | 658.08 g/mol |
| Exact Mass | 657.07 |
| IUPAC Name | 2-(2-hydroxyethylsulfanyl)ethoxy N-[2-[2-[2-[2-(2-methylsulfanylethyliminomethylsulfinyl)ethylsulfanylmethylsulfanyl]ethylsulfanylcarbonylamino]ethylsulfanylmethylsulfanyl]ethyl]methanimidate |
| SMILES | CSCC/N=C/S(=O)CCSCSCCSC(=O)NCCSCSCC/N=C/OOCCSCCO |
| InChI | InChI=1S/C20H39N3O5S8/c1-29-7-2-22-17-36(26)15-14-34-19-33-12-13-35-20(25)23-4-9-32-18-31-8-3-21-16-28-27-6-11-30-10-5-24/h16-17,24H,2-15,18-19H2,1H3,(H,23,25)/b21-16+,22-17+ |
| InChIKey | KGQWWUAMUCYXEM-LPFJTETCSA-N |
| XLogP | 4.12 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.08 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|