C19H37N3O5S9 — CID 59488304
hydroxymethylsulfanylmethoxy N-[2-[2-[2-[2-(ethyliminomethylsulfinyl)ethylsulfanylmethylsulfanylmethylsulfanyl]ethylsulfanylcarbonylamino]ethylsulfanylmethylsulfanylmethylsulfanyl]ethyl]methanimidate (PubChem CID 59488304) has the molecular formula C19H37N3O5S9 and a molecular weight of 676.12 g/mol. Its IUPAC name is hydroxymethylsulfanylmethoxy N-[2-[2-[2-[2-(ethyliminomethylsulfinyl)ethylsulfanylmethylsulfanylmethylsulfanyl]ethylsulfanylcarbonylamino]ethylsulfanylmethylsulfanylmethylsulfanyl]ethyl]methanimidate.
| Compound Name | hydroxymethylsulfanylmethoxy N-[2-[2-[2-[2-(ethyliminomethylsulfinyl)ethylsulfanylmethylsulfanylmethylsulfanyl]ethylsulfanylcarbonylamino]ethylsulfanylmethylsulfanylmethylsulfanyl]ethyl]methanimidate |
|---|---|
| PubChem CID | 59488304 |
| Molecular Formula | C19H37N3O5S9 |
| Molecular Weight | 676.12 g/mol |
| Exact Mass | 675.02 |
| IUPAC Name | hydroxymethylsulfanylmethoxy N-[2-[2-[2-[2-(ethyliminomethylsulfinyl)ethylsulfanylmethylsulfanylmethylsulfanyl]ethylsulfanylcarbonylamino]ethylsulfanylmethylsulfanylmethylsulfanyl]ethyl]methanimidate |
| SMILES | CC/N=C/S(=O)CCSCSCSCCSC(=O)NCCSCSCSCC/N=C/OOCSCO |
| InChI | InChI=1S/C19H37N3O5S9/c1-2-20-12-36(25)10-9-31-18-34-17-30-7-8-35-19(24)22-4-6-29-16-33-15-28-5-3-21-11-26-27-14-32-13-23/h11-12,23H,2-10,13-18H2,1H3,(H,22,24)/b20-12+,21-11+ |
| InChIKey | SBFZVWORWYCKMY-OMTKTPHQSA-N |
| XLogP | 5.07 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.12 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|