C46H36N2Si — CID 59489119
[4-[4-[3,5-di(carbazol-9-yl)phenyl]phenyl]phenyl]-ethenyl-dimethylsilane (PubChem CID 59489119) has the molecular formula C46H36N2Si and a molecular weight of 644.89 g/mol. Its IUPAC name is [4-[4-[3,5-di(carbazol-9-yl)phenyl]phenyl]phenyl]-ethenyl-dimethylsilane.
| Compound Name | [4-[4-[3,5-di(carbazol-9-yl)phenyl]phenyl]phenyl]-ethenyl-dimethylsilane |
|---|---|
| PubChem CID | 59489119 |
| Molecular Formula | C46H36N2Si |
| Molecular Weight | 644.89 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | [4-[4-[3,5-di(carbazol-9-yl)phenyl]phenyl]phenyl]-ethenyl-dimethylsilane |
| SMILES | C=C[Si](C)(C)c1ccc(-c2ccc(-c3cc(-n4c5ccccc5c5ccccc54)cc(-n4c5ccccc5c5ccccc54)c3)cc2)cc1 |
| InChI | InChI=1S/C46H36N2Si/c1-4-49(2,3)38-27-25-33(26-28-38)32-21-23-34(24-22-32)35-29-36(47-43-17-9-5-13-39(43)40-14-6-10-18-44(40)47)31-37(30-35)48-45-19-11-7-15-41(45)42-16-8-12-20-46(42)48/h4-31H,1H2,2-3H3 |
| InChIKey | KKDYOHMREZWYPS-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.89 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|