C44H44N2Si2 — CID 59399853
ethyl-[9-[3-[3-[ethyl(dimethyl)silyl]carbazol-9-yl]-5-phenylphenyl]carbazol-3-yl]-dimethylsilane (PubChem CID 59399853) has the molecular formula C44H44N2Si2 and a molecular weight of 657.02 g/mol. Its IUPAC name is ethyl-[9-[3-[3-[ethyl(dimethyl)silyl]carbazol-9-yl]-5-phenylphenyl]carbazol-3-yl]-dimethylsilane.
| Compound Name | ethyl-[9-[3-[3-[ethyl(dimethyl)silyl]carbazol-9-yl]-5-phenylphenyl]carbazol-3-yl]-dimethylsilane |
|---|---|
| PubChem CID | 59399853 |
| Molecular Formula | C44H44N2Si2 |
| Molecular Weight | 657.02 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | ethyl-[9-[3-[3-[ethyl(dimethyl)silyl]carbazol-9-yl]-5-phenylphenyl]carbazol-3-yl]-dimethylsilane |
| SMILES | CC[Si](C)(C)c1ccc2c(c1)c1ccccc1n2-c1cc(-c2ccccc2)cc(-n2c3ccccc3c3cc([Si](C)(C)CC)ccc32)c1 |
| InChI | InChI=1S/C44H44N2Si2/c1-7-47(3,4)35-22-24-43-39(29-35)37-18-12-14-20-41(37)45(43)33-26-32(31-16-10-9-11-17-31)27-34(28-33)46-42-21-15-13-19-38(42)40-30-36(23-25-44(40)46)48(5,6)8-2/h9-30H,7-8H2,1-6H3 |
| InChIKey | YZMFQKJULAYLCG-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.02 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|