C42H42N2Si2 — CID 148605832
trimethyl-[9-[3-phenyl-5-(3-trimethylsilylcarbazol-9-yl)phenyl]-1,2-dihydrocarbazol-3-yl]silane (PubChem CID 148605832) has the molecular formula C42H42N2Si2 and a molecular weight of 630.98 g/mol. Its IUPAC name is trimethyl-[9-[3-phenyl-5-(3-trimethylsilylcarbazol-9-yl)phenyl]-1,2-dihydrocarbazol-3-yl]silane.
| Compound Name | trimethyl-[9-[3-phenyl-5-(3-trimethylsilylcarbazol-9-yl)phenyl]-1,2-dihydrocarbazol-3-yl]silane |
|---|---|
| PubChem CID | 148605832 |
| Molecular Formula | C42H42N2Si2 |
| Molecular Weight | 630.98 g/mol |
| Exact Mass | 630.29 |
| IUPAC Name | trimethyl-[9-[3-phenyl-5-(3-trimethylsilylcarbazol-9-yl)phenyl]-1,2-dihydrocarbazol-3-yl]silane |
| SMILES | C[Si](C)(C)C1=Cc2c(n(-c3cc(-c4ccccc4)cc(-n4c5ccccc5c5cc([Si](C)(C)C)ccc54)c3)c3ccccc23)CC1 |
| InChI | InChI=1S/C42H42N2Si2/c1-45(2,3)33-20-22-41-37(27-33)35-16-10-12-18-39(35)43(41)31-24-30(29-14-8-7-9-15-29)25-32(26-31)44-40-19-13-11-17-36(40)38-28-34(46(4,5)6)21-23-42(38)44/h7-20,22,24-28H,21,23H2,1-6H3 |
| InChIKey | NDJOXYMQQUZAED-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.98 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|