C16H11F3O3 — CID 59492599
methyl 9-hydroxy-9-(trifluoromethyl)fluorene-4-carboxylate (PubChem CID 59492599) has the molecular formula C16H11F3O3 and a molecular weight of 308.26 g/mol. Its IUPAC name is methyl 9-hydroxy-9-(trifluoromethyl)fluorene-4-carboxylate.
| Compound Name | methyl 9-hydroxy-9-(trifluoromethyl)fluorene-4-carboxylate |
|---|---|
| PubChem CID | 59492599 |
| Molecular Formula | C16H11F3O3 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | methyl 9-hydroxy-9-(trifluoromethyl)fluorene-4-carboxylate |
| SMILES | COC(=O)c1cccc2c1-c1ccccc1C2(O)C(F)(F)F |
| InChI | InChI=1S/C16H11F3O3/c1-22-14(20)10-6-4-8-12-13(10)9-5-2-3-7-11(9)15(12,21)16(17,18)19/h2-8,21H,1H3 |
| InChIKey | STXAPIKTOCNBKD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |