C16H10ClF3O3 — CID 59492784
methyl 2-chloro-9-hydroxy-9-(trifluoromethyl)fluorene-4-carboxylate (PubChem CID 59492784) has the molecular formula C16H10ClF3O3 and a molecular weight of 342.70 g/mol. Its IUPAC name is methyl 2-chloro-9-hydroxy-9-(trifluoromethyl)fluorene-4-carboxylate.
| Compound Name | methyl 2-chloro-9-hydroxy-9-(trifluoromethyl)fluorene-4-carboxylate |
|---|---|
| PubChem CID | 59492784 |
| Molecular Formula | C16H10ClF3O3 |
| Molecular Weight | 342.70 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | methyl 2-chloro-9-hydroxy-9-(trifluoromethyl)fluorene-4-carboxylate |
| SMILES | COC(=O)c1cc(Cl)cc2c1-c1ccccc1C2(O)C(F)(F)F |
| InChI | InChI=1S/C16H10ClF3O3/c1-23-14(21)10-6-8(17)7-12-13(10)9-4-2-3-5-11(9)15(12,22)16(18,19)20/h2-7,22H,1H3 |
| InChIKey | JCEKEIDOLNOUNU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.70 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |