C21H16F3NO — CID 59492834
2-(N-methylanilino)-9-(trifluoromethyl)fluoren-9-ol (PubChem CID 59492834) has the molecular formula C21H16F3NO and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-(N-methylanilino)-9-(trifluoromethyl)fluoren-9-ol.
| Compound Name | 2-(N-methylanilino)-9-(trifluoromethyl)fluoren-9-ol |
|---|---|
| PubChem CID | 59492834 |
| Molecular Formula | C21H16F3NO |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-(N-methylanilino)-9-(trifluoromethyl)fluoren-9-ol |
| SMILES | CN(c1ccccc1)c1ccc2c(c1)C(O)(C(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C21H16F3NO/c1-25(14-7-3-2-4-8-14)15-11-12-17-16-9-5-6-10-18(16)20(26,19(17)13-15)21(22,23)24/h2-13,26H,1H3 |
| InChIKey | KZQIULSJWDDSCT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |