C18H13ClF3NO3 — CID 59492857
[4-chloro-9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]-(3-hydroxyazetidin-1-yl)methanone (PubChem CID 59492857) has the molecular formula C18H13ClF3NO3 and a molecular weight of 383.75 g/mol. Its IUPAC name is [4-chloro-9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]-(3-hydroxyazetidin-1-yl)methanone.
| Compound Name | [4-chloro-9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]-(3-hydroxyazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 59492857 |
| Molecular Formula | C18H13ClF3NO3 |
| Molecular Weight | 383.75 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | [4-chloro-9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]-(3-hydroxyazetidin-1-yl)methanone |
| SMILES | O=C(c1cc(Cl)c2c(c1)C(O)(C(F)(F)F)c1ccccc1-2)N1CC(O)C1 |
| InChI | InChI=1S/C18H13ClF3NO3/c19-14-6-9(16(25)23-7-10(24)8-23)5-13-15(14)11-3-1-2-4-12(11)17(13,26)18(20,21)22/h1-6,10,24,26H,7-8H2 |
| InChIKey | UXGKINYHMPFDCK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.75 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |