C19H18F3NO — CID 59493124
2-piperidin-1-yl-9-(trifluoromethyl)fluoren-9-ol (PubChem CID 59493124) has the molecular formula C19H18F3NO and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-piperidin-1-yl-9-(trifluoromethyl)fluoren-9-ol.
| Compound Name | 2-piperidin-1-yl-9-(trifluoromethyl)fluoren-9-ol |
|---|---|
| PubChem CID | 59493124 |
| Molecular Formula | C19H18F3NO |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-piperidin-1-yl-9-(trifluoromethyl)fluoren-9-ol |
| SMILES | OC1(C(F)(F)F)c2ccccc2-c2ccc(N3CCCCC3)cc21 |
| InChI | InChI=1S/C19H18F3NO/c20-19(21,22)18(24)16-7-3-2-6-14(16)15-9-8-13(12-17(15)18)23-10-4-1-5-11-23/h2-3,6-9,12,24H,1,4-5,10-11H2 |
| InChIKey | VMQZDICKSLUXDZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |