C28H28BrNO2 — CID 59494010
ethyl 1-[(3-bromophenyl)methyl]-3-(4-tert-butylphenyl)indole-2-carboxylate (PubChem CID 59494010) has the molecular formula C28H28BrNO2 and a molecular weight of 490.44 g/mol. Its IUPAC name is ethyl 1-[(3-bromophenyl)methyl]-3-(4-tert-butylphenyl)indole-2-carboxylate.
| Compound Name | ethyl 1-[(3-bromophenyl)methyl]-3-(4-tert-butylphenyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 59494010 |
| Molecular Formula | C28H28BrNO2 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | ethyl 1-[(3-bromophenyl)methyl]-3-(4-tert-butylphenyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C(C)(C)C)cc2)c2ccccc2n1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C28H28BrNO2/c1-5-32-27(31)26-25(20-13-15-21(16-14-20)28(2,3)4)23-11-6-7-12-24(23)30(26)18-19-9-8-10-22(29)17-19/h6-17H,5,18H2,1-4H3 |
| InChIKey | OHTJGCNEEYMAIJ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |