C36H37NO5 — CID 24947095
3-(4-tert-butylphenyl)-1-[[3-(2-methoxyethoxy)-5-phenylmethoxyphenyl]methyl]indole-2-carboxylic acid (PubChem CID 24947095) has the molecular formula C36H37NO5 and a molecular weight of 563.69 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-[[3-(2-methoxyethoxy)-5-phenylmethoxyphenyl]methyl]indole-2-carboxylic acid.
| Compound Name | 3-(4-tert-butylphenyl)-1-[[3-(2-methoxyethoxy)-5-phenylmethoxyphenyl]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 24947095 |
| Molecular Formula | C36H37NO5 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-[[3-(2-methoxyethoxy)-5-phenylmethoxyphenyl]methyl]indole-2-carboxylic acid |
| SMILES | COCCOc1cc(Cn2c(C(=O)O)c(-c3ccc(C(C)(C)C)cc3)c3ccccc32)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C36H37NO5/c1-36(2,3)28-16-14-27(15-17-28)33-31-12-8-9-13-32(31)37(34(33)35(38)39)23-26-20-29(41-19-18-40-4)22-30(21-26)42-24-25-10-6-5-7-11-25/h5-17,20-22H,18-19,23-24H2,1-4H3,(H,38,39) |
| InChIKey | RSHTXMDANLWUKX-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|