C22H20FN5O2 — CID 59496435
N-[1-[[4-(4-fluoroanilino)phenyl]methylcarbamoyl]cyclopropyl]pyrimidine-5-carboxamide (PubChem CID 59496435) has the molecular formula C22H20FN5O2 and a molecular weight of 405.43 g/mol. Its IUPAC name is N-[1-[[4-(4-fluoroanilino)phenyl]methylcarbamoyl]cyclopropyl]pyrimidine-5-carboxamide.
| Compound Name | N-[1-[[4-(4-fluoroanilino)phenyl]methylcarbamoyl]cyclopropyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59496435 |
| Molecular Formula | C22H20FN5O2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[1-[[4-(4-fluoroanilino)phenyl]methylcarbamoyl]cyclopropyl]pyrimidine-5-carboxamide |
| SMILES | O=C(NC1(C(=O)NCc2ccc(Nc3ccc(F)cc3)cc2)CC1)c1cncnc1 |
| InChI | InChI=1S/C22H20FN5O2/c23-17-3-7-19(8-4-17)27-18-5-1-15(2-6-18)11-26-21(30)22(9-10-22)28-20(29)16-12-24-14-25-13-16/h1-8,12-14,27H,9-11H2,(H,26,30)(H,28,29) |
| InChIKey | SLJXYGDEXWXCRU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |