C16H14BrFN4O2 — CID 69268257
N-[1-[(4-bromo-2-fluorophenyl)methylcarbamoyl]cyclopropyl]pyrimidine-5-carboxamide (PubChem CID 69268257) has the molecular formula C16H14BrFN4O2 and a molecular weight of 393.22 g/mol. Its IUPAC name is N-[1-[(4-bromo-2-fluorophenyl)methylcarbamoyl]cyclopropyl]pyrimidine-5-carboxamide.
| Compound Name | N-[1-[(4-bromo-2-fluorophenyl)methylcarbamoyl]cyclopropyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 69268257 |
| Molecular Formula | C16H14BrFN4O2 |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N-[1-[(4-bromo-2-fluorophenyl)methylcarbamoyl]cyclopropyl]pyrimidine-5-carboxamide |
| SMILES | O=C(NC1(C(=O)NCc2ccc(Br)cc2F)CC1)c1cncnc1 |
| InChI | InChI=1S/C16H14BrFN4O2/c17-12-2-1-10(13(18)5-12)8-21-15(24)16(3-4-16)22-14(23)11-6-19-9-20-7-11/h1-2,5-7,9H,3-4,8H2,(H,21,24)(H,22,23) |
| InChIKey | JJLZQOUAYJSLPL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |