About O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+)
O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+) (PubChem CID 59498548) has the molecular formula C5H10O3PRbS2
and a molecular weight of 298.71 g/mol. Its IUPAC name is O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+).
Molecular Properties
| Compound Name | O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+) |
| PubChem CID | 59498548 |
| Molecular Formula | C5H10O3PRbS2 |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 297.89 |
| IUPAC Name | O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+) |
| SMILES | COC(=S)S[CH-]OP(C)(C)=O.[Rb+] |
| InChI | InChI=1S/C5H10O3PS2.Rb/c1-7-5(10)11-4-8-9(2,3)6;/h4H,1-3H3;/q-1;+1 |
| InChIKey | RNZBRTDYIMOPBE-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+)?
The IUPAC name of O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+) (CID 59498548) is O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+).
What is the SMILES notation for O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+)?
The canonical SMILES for O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+) is COC(=S)S[CH-]OP(C)(C)=O.[Rb+].
What is the InChIKey of O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+)?
The InChIKey is RNZBRTDYIMOPBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3PS2.Rb/c1-7-5(10)11-4-8-9(2,3)6;/h4H,1-3H3;/q-1;+1.
What are the key properties of O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+)?
O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+) has a molecular weight of 298.71 g/mol, XLogP of -0.67, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl dimethylphosphoryloxymethylsulfanylmethanethioate;rubidium(1+) is sourced from PubChem (CID 59498548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).