C43H37N3 — CID 59499889
4-[3-(4-tert-butylphenyl)-5-(4-phenylphenyl)pyrazol-1-yl]-N,N-diphenylaniline (PubChem CID 59499889) has the molecular formula C43H37N3 and a molecular weight of 595.79 g/mol. Its IUPAC name is 4-[3-(4-tert-butylphenyl)-5-(4-phenylphenyl)pyrazol-1-yl]-N,N-diphenylaniline.
| Compound Name | 4-[3-(4-tert-butylphenyl)-5-(4-phenylphenyl)pyrazol-1-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 59499889 |
| Molecular Formula | C43H37N3 |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | 4-[3-(4-tert-butylphenyl)-5-(4-phenylphenyl)pyrazol-1-yl]-N,N-diphenylaniline |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(-c4ccccc4)cc3)n(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C43H37N3/c1-43(2,3)36-25-23-34(24-26-36)41-31-42(35-21-19-33(20-22-35)32-13-7-4-8-14-32)46(44-41)40-29-27-39(28-30-40)45(37-15-9-5-10-16-37)38-17-11-6-12-18-38/h4-31H,1-3H3 |
| InChIKey | QKQMIRBHEWGJRT-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |