C42H32IrN3S — CID 59500153
2-(2H-dibenzothiophen-2-id-3-yl)-5-methylpyridine;iridium(3+);bis(2-methyl-6-phenylpyridine) (PubChem CID 59500153) has the molecular formula C42H32IrN3S and a molecular weight of 803.02 g/mol. Its IUPAC name is 2-(2H-dibenzothiophen-2-id-3-yl)-5-methylpyridine;iridium(3+);bis(2-methyl-6-phenylpyridine).
| Compound Name | 2-(2H-dibenzothiophen-2-id-3-yl)-5-methylpyridine;iridium(3+);bis(2-methyl-6-phenylpyridine) |
|---|---|
| PubChem CID | 59500153 |
| Molecular Formula | C42H32IrN3S |
| Molecular Weight | 803.02 g/mol |
| Exact Mass | 803.19 |
| IUPAC Name | 2-(2H-dibenzothiophen-2-id-3-yl)-5-methylpyridine;iridium(3+);bis(2-methyl-6-phenylpyridine) |
| SMILES | Cc1ccc(-c2[c-]cc3c(c2)sc2ccccc23)nc1.Cc1cccc(-c2[c-]cccc2)n1.Cc1cccc(-c2[c-]cccc2)n1.[Ir+3] |
| InChI | InChI=1S/C18H12NS.2C12H10N.Ir/c1-12-6-9-16(19-11-12)13-7-8-15-14-4-2-3-5-17(14)20-18(15)10-13;2*1-10-6-5-9-12(13-10)11-7-3-2-4-8-11;/h2-6,8-11H,1H3;2*2-7,9H,1H3;/q3*-1;+3 |
| InChIKey | WCKKNODCRALDCX-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.02 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|