About 2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine)
2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine) (PubChem CID 59500162) has the molecular formula C39H26IrN3S
and a molecular weight of 760.94 g/mol. Its IUPAC name is 2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine).
Molecular Properties
| Compound Name | 2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine) |
| PubChem CID | 59500162 |
| Molecular Formula | C39H26IrN3S |
| Molecular Weight | 760.94 g/mol |
| Exact Mass | 761.15 |
| IUPAC Name | 2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine) |
| SMILES | [Ir+3].[c-]1cc2c(cc1-c1ccccn1)sc1ccccc12.[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C17H10NS.2C11H8N.Ir/c1-2-7-16-13(5-1)14-9-8-12(11-17(14)19-16)15-6-3-4-10-18-15;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-7,9-11H;2*1-6,8-9H;/q3*-1;+3 |
| InChIKey | HJOLYHLWYXUROH-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 760.94 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine)?
The IUPAC name of 2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine) (CID 59500162) is 2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine).
What is the SMILES notation for 2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine)?
The canonical SMILES for 2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine) is [Ir+3].[c-]1cc2c(cc1-c1ccccn1)sc1ccccc12.[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1.
What is the InChIKey of 2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine)?
The InChIKey is HJOLYHLWYXUROH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10NS.2C11H8N.Ir/c1-2-7-16-13(5-1)14-9-8-12(11-17(14)19-16)15-6-3-4-10-18-15;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-7,9-11H;2*1-6,8-9H;/q3*-1;+3.
What are the key properties of 2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine)?
2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine) has a molecular weight of 760.94 g/mol, XLogP of 10.01, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2H-dibenzothiophen-2-id-3-yl)pyridine;iridium(3+);bis(2-phenylpyridine) is sourced from PubChem (CID 59500162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).