C20H17FIO3- — CID 59503269
2-[4-(4-fluorophenyl)iodanuidylphenoxy]-4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 59503269) has the molecular formula C20H17FIO3- and a molecular weight of 451.26 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)iodanuidylphenoxy]-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
| Compound Name | 2-[4-(4-fluorophenyl)iodanuidylphenoxy]-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
|---|---|
| PubChem CID | 59503269 |
| Molecular Formula | C20H17FIO3- |
| Molecular Weight | 451.26 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 2-[4-(4-fluorophenyl)iodanuidylphenoxy]-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | O=C1OC2C3CC(CC13)C2Oc1ccc([I-]c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H17FIO3/c21-12-1-3-13(4-2-12)22-14-5-7-15(8-6-14)24-18-11-9-16-17(10-11)20(23)25-19(16)18/h1-8,11,16-19H,9-10H2/q-1 |
| InChIKey | AIHREXGBMRDZRF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|