C25H24NO4S- — CID 59506677
4-[3-[[1-(4-methoxyphenyl)cyclopentanecarbonyl]amino]phenyl]benzenesulfinate (PubChem CID 59506677) has the molecular formula C25H24NO4S- and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-[3-[[1-(4-methoxyphenyl)cyclopentanecarbonyl]amino]phenyl]benzenesulfinate.
| Compound Name | 4-[3-[[1-(4-methoxyphenyl)cyclopentanecarbonyl]amino]phenyl]benzenesulfinate |
|---|---|
| PubChem CID | 59506677 |
| Molecular Formula | C25H24NO4S- |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 4-[3-[[1-(4-methoxyphenyl)cyclopentanecarbonyl]amino]phenyl]benzenesulfinate |
| SMILES | COc1ccc(C2(C(=O)Nc3cccc(-c4ccc(S(=O)[O-])cc4)c3)CCCC2)cc1 |
| InChI | InChI=1S/C25H25NO4S/c1-30-22-11-9-20(10-12-22)25(15-2-3-16-25)24(27)26-21-6-4-5-19(17-21)18-7-13-23(14-8-18)31(28)29/h4-14,17H,2-3,15-16H2,1H3,(H,26,27)(H,28,29)/p-1 |
| InChIKey | ZXOOMMXRXMRLFC-UHFFFAOYSA-M |
| XLogP | 5.05 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|