C20H19N4O3S+ — CID 59506860
(2,4-dimethyl-2H-imidazol-1-ium-1-yl)-[4-(3-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 59506860) has the molecular formula C20H19N4O3S+ and a molecular weight of 395.46 g/mol. Its IUPAC name is (2,4-dimethyl-2H-imidazol-1-ium-1-yl)-[4-(3-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (2,4-dimethyl-2H-imidazol-1-ium-1-yl)-[4-(3-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 59506860 |
| Molecular Formula | C20H19N4O3S+ |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (2,4-dimethyl-2H-imidazol-1-ium-1-yl)-[4-(3-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | CC1=NC(C)[N+](C(=O)c2c[nH]c3nccc(-c4cccc(S(C)(=O)=O)c4)c23)=C1 |
| InChI | InChI=1S/C20H18N4O3S/c1-12-11-24(13(2)23-12)20(25)17-10-22-19-18(17)16(7-8-21-19)14-5-4-6-15(9-14)28(3,26)27/h4-11,13H,1-3H3/p+1 |
| InChIKey | YXDXSQHHJBSGBT-UHFFFAOYSA-O |
| XLogP | 2.68 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|