C36H29N5O5S — CID 59507102
N-[3-[5-[(4-methoxyphenyl)methyl]-10,12-dioxo-11-(2-phenylethyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-3-yl]phenyl]benzenesulfonamide (PubChem CID 59507102) has the molecular formula C36H29N5O5S and a molecular weight of 643.73 g/mol. Its IUPAC name is N-[3-[5-[(4-methoxyphenyl)methyl]-10,12-dioxo-11-(2-phenylethyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-3-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-[5-[(4-methoxyphenyl)methyl]-10,12-dioxo-11-(2-phenylethyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-3-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59507102 |
| Molecular Formula | C36H29N5O5S |
| Molecular Weight | 643.73 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | N-[3-[5-[(4-methoxyphenyl)methyl]-10,12-dioxo-11-(2-phenylethyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-3-yl]phenyl]benzenesulfonamide |
| SMILES | COc1ccc(Cn2nc(-c3cccc(NS(=O)(=O)c4ccccc4)c3)c3c4c(cnc32)C(=O)N(CCc2ccccc2)C4=O)cc1 |
| InChI | InChI=1S/C36H29N5O5S/c1-46-28-17-15-25(16-18-28)23-41-34-32(31-30(22-37-34)35(42)40(36(31)43)20-19-24-9-4-2-5-10-24)33(38-41)26-11-8-12-27(21-26)39-47(44,45)29-13-6-3-7-14-29/h2-18,21-22,39H,19-20,23H2,1H3 |
| InChIKey | DDJVDZHGAVERFY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.73 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|