C8H7N3O — CID 595072
2-methyl-5-pyridin-2-yl-1,3,4-oxadiazole (PubChem CID 595072) has the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-methyl-5-pyridin-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-methyl-5-pyridin-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 595072 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 2-methyl-5-pyridin-2-yl-1,3,4-oxadiazole |
| SMILES | Cc1nnc(-c2ccccn2)o1 |
| InChI | InChI=1S/C8H7N3O/c1-6-10-11-8(12-6)7-4-2-3-5-9-7/h2-5H,1H3 |
| InChIKey | JDVGMDNWELATGD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |