C22H27ClFNO2 — CID 59512611
(2S)-2-[(4-chlorophenyl)methyl]-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide (PubChem CID 59512611) has the molecular formula C22H27ClFNO2 and a molecular weight of 391.91 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)methyl]-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide.
| Compound Name | (2S)-2-[(4-chlorophenyl)methyl]-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide |
|---|---|
| PubChem CID | 59512611 |
| Molecular Formula | C22H27ClFNO2 |
| Molecular Weight | 391.91 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)methyl]-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide |
| SMILES | Cc1cc(CCCCCC[C@@H](Cc2ccc(Cl)cc2)C(=O)NO)ccc1F |
| InChI | InChI=1S/C22H27ClFNO2/c1-16-14-17(10-13-21(16)24)6-4-2-3-5-7-19(22(26)25-27)15-18-8-11-20(23)12-9-18/h8-14,19,27H,2-7,15H2,1H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | SOQQVEDLLLGCCT-IBGZPJMESA-N |
| XLogP | 5.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.91 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|