C18H22ClNO2 — CID 71719498
2-[3-(4-chlorophenyl)-1-adamantyl]-N-hydroxyacetamide (PubChem CID 71719498) has the molecular formula C18H22ClNO2 and a molecular weight of 319.83 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-1-adamantyl]-N-hydroxyacetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-1-adamantyl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 71719498 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-1-adamantyl]-N-hydroxyacetamide |
| SMILES | O=C(CC12CC3CC(C1)CC(c1ccc(Cl)cc1)(C3)C2)NO |
| InChI | InChI=1S/C18H22ClNO2/c19-15-3-1-14(2-4-15)18-8-12-5-13(9-18)7-17(6-12,11-18)10-16(21)20-22/h1-4,12-13,22H,5-11H2,(H,20,21) |
| InChIKey | ONPVMOALGKWBBR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|