C20H15ClFNO2 — CID 135320326
2-[3-(4-chloro-3-fluorophenyl)phenyl]-N-hydroxy-2-phenylacetamide (PubChem CID 135320326) has the molecular formula C20H15ClFNO2 and a molecular weight of 355.80 g/mol. Its IUPAC name is 2-[3-(4-chloro-3-fluorophenyl)phenyl]-N-hydroxy-2-phenylacetamide.
| Compound Name | 2-[3-(4-chloro-3-fluorophenyl)phenyl]-N-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 135320326 |
| Molecular Formula | C20H15ClFNO2 |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-[3-(4-chloro-3-fluorophenyl)phenyl]-N-hydroxy-2-phenylacetamide |
| SMILES | O=C(NO)C(c1ccccc1)c1cccc(-c2ccc(Cl)c(F)c2)c1 |
| InChI | InChI=1S/C20H15ClFNO2/c21-17-10-9-15(12-18(17)22)14-7-4-8-16(11-14)19(20(24)23-25)13-5-2-1-3-6-13/h1-12,19,25H,(H,23,24) |
| InChIKey | DLWKHCPNMMKVKD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|