C22H16FNO2 — CID 135320467
2-[4-[2-(2-fluorophenyl)ethynyl]phenyl]-N-hydroxy-2-phenylacetamide (PubChem CID 135320467) has the molecular formula C22H16FNO2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 2-[4-[2-(2-fluorophenyl)ethynyl]phenyl]-N-hydroxy-2-phenylacetamide.
| Compound Name | 2-[4-[2-(2-fluorophenyl)ethynyl]phenyl]-N-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 135320467 |
| Molecular Formula | C22H16FNO2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-[4-[2-(2-fluorophenyl)ethynyl]phenyl]-N-hydroxy-2-phenylacetamide |
| SMILES | O=C(NO)C(c1ccccc1)c1ccc(C#Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C22H16FNO2/c23-20-9-5-4-6-17(20)13-10-16-11-14-19(15-12-16)21(22(25)24-26)18-7-2-1-3-8-18/h1-9,11-12,14-15,21,26H,(H,24,25) |
| InChIKey | YTEIJRQGBATOBD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|